2-Oxazolidinone,4,5,5-triphenyl- structure
|
Common Name | 2-Oxazolidinone,4,5,5-triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 62183-23-7 | Molecular Weight | 315.36500 | |
| Density | 1.197 g/cm3 | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C21H17NO2 | Melting Point | 245-249ºC(lit.) | |
| MSDS | N/A | Flash Point | 264.1ºC | |
| Name | (4S)-4,5,5-triphenyl-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197 g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760 mmHg |
| Melting Point | 245-249ºC(lit.) |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.36500 |
| Flash Point | 264.1ºC |
| Exact Mass | 315.12600 |
| PSA | 38.33000 |
| LogP | 4.74010 |
| Index of Refraction | 1.617 |
| InChIKey | QCWBJFYOEHCELV-UHFFFAOYSA-N |
| SMILES | O=C1NC(c2ccccc2)C(c2ccccc2)(c2ccccc2)O1 |
| Safety Phrases | S22 |
|---|---|
| HS Code | 2934999090 |
|
~%
2-Oxazolidinone... CAS#:62183-23-7 |
| Literature: Journal of the American Chemical Society, , vol. 73, p. 4199,4202 |
|
~%
2-Oxazolidinone... CAS#:62183-23-7 |
| Literature: Chemische Berichte, , vol. 104, p. 2134 - 2142 |
|
~%
2-Oxazolidinone... CAS#:62183-23-7 |
| Literature: Chemische Berichte, , vol. 104, p. 2134 - 2142 |
|
~%
2-Oxazolidinone... CAS#:62183-23-7 |
| Literature: Chemische Berichte, , vol. 104, p. 2134 - 2142 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03093541 |
| 4,5,5-triphenyloxazolidin-2-one |
| 4,5,5-Triphenyl-2-oxazolidon |
| 2-Oxazolidinone,4,5,5-triphenyl |