4-Chlor-7-fluor-6-methoxychinolin-3-carbonitril structure
|
Common Name | 4-Chlor-7-fluor-6-methoxychinolin-3-carbonitril | ||
|---|---|---|---|---|
| CAS Number | 622369-40-8 | Molecular Weight | 236.630 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 394.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H6ClFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.5±26.5 °C | |
| Name | 4-Chloro-7-fluoro-6-methoxyquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.8±37.0 °C at 760 mmHg |
| Molecular Formula | C11H6ClFN2O |
| Molecular Weight | 236.630 |
| Flash Point | 192.5±26.5 °C |
| Exact Mass | 236.015274 |
| PSA | 45.91000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | PNVRUIFACIJUKH-UHFFFAOYSA-N |
| SMILES | COc1cc2c(Cl)c(C#N)cnc2cc1F |
| Storage condition | 2-8°C |
| Hazard Codes | Xn |
|---|
|
~46%
4-Chlor-7-fluor... CAS#:622369-40-8 |
| Literature: Wyeth Patent: US2009/264427 A1, 2009 ; Location in patent: Page/Page column 13 ; US 20090264427 A1 |
|
~75%
4-Chlor-7-fluor... CAS#:622369-40-8 |
| Literature: Boschelli, Diane H.; Wang, Yanong D.; Johnson, Steve; Wu, Biqi; Ye, Fei; Barrios Sosa, Ana Carolina; Golas, Jennifer M.; Boschelli, Frank Journal of Medicinal Chemistry, 2004 , vol. 47, # 7 p. 1599 - 1601 |
|
~%
4-Chlor-7-fluor... CAS#:622369-40-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 7 p. 1599 - 1601 |
| 4-Chlor-7-fluor-6-methoxychinolin-3-carbonitril |
| 3-Quinolinecarbonitrile, 4-chloro-7-fluoro-6-methoxy- |
| 4-Chloro-7-fluoro-6-methoxy-3-quinolinecarbonitrile |
| 4-chloro-7-fluoro-6-methoxyquinoline-3-carbonitrile |