(3,3,3-Triphenylpropyl)phosphonium bromide structure
|
Common Name | (3,3,3-Triphenylpropyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 6228-47-3 | Molecular Weight | 385.277 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22BrP | Melting Point | 236-238 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Propyltriphenylphosphonium bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 236-238 °C |
|---|---|
| Molecular Formula | C21H22BrP |
| Molecular Weight | 385.277 |
| Exact Mass | 384.064240 |
| PSA | 13.59000 |
| LogP | 1.39450 |
| InChIKey | XMQSELBBYSAURN-UHFFFAOYSA-M |
| SMILES | CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Water Solubility | soluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R21/22;R36/37/38 |
| Safety Phrases | S36/37-S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~95%
(3,3,3-Tripheny... CAS#:6228-47-3 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 2307 - 2326 |
|
~96%
(3,3,3-Tripheny... CAS#:6228-47-3 |
| Literature: Phosphorus, Sulfur and Silicon and the Related Elements, , vol. 48, # 1-4 p. 279 - 280 |
|
~%
(3,3,3-Tripheny... CAS#:6228-47-3 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 709, p. 105 - 112 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00011843 |
| EINECS 228-330-2 |
| Phosphine, (3,3,3-triphenylpropyl)-, hydrobromide (1:1) |
| triphenyl(propyl)phosphanium,bromide |
| (3,3,3-Triphenylpropyl)phosphonium bromide |