5-[benzyl(methyl)amino]-2-methylpent-3-yn-2-ol structure
|
Common Name | 5-[benzyl(methyl)amino]-2-methylpent-3-yn-2-ol | ||
|---|---|---|---|---|
| CAS Number | 62505-91-3 | Molecular Weight | 217.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[benzyl(methyl)amino]-2-methylpent-3-yn-2-ol |
|---|
| Molecular Formula | C14H19NO |
|---|---|
| Molecular Weight | 217.30700 |
| Exact Mass | 217.14700 |
| PSA | 23.47000 |
| LogP | 1.89270 |
| InChIKey | OGZLCDOCGKKCDE-UHFFFAOYSA-N |
| SMILES | CN(CC#CC(C)(C)O)Cc1ccccc1 |
|
~%
5-[benzyl(methy... CAS#:62505-91-3 |
| Literature: Fowler The Journal of organic chemistry, 1977 , vol. 42, # 15 p. 2637 - 2637 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |