(3,5-dichlorophenyl)ureidoformate
(3,5-dichlorophenyl)ureidoformate structure
|
Common Name | (3,5-dichlorophenyl)ureidoformate | ||
|---|---|---|---|---|
| CAS Number | 62584-33-2 | Molecular Weight | 263.07700 | |
| Density | 1.581g/cm3 | Boiling Point | 418.8ºC at 760mmHg | |
| Molecular Formula | C9H8Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3,5-dichlorophenyl)ureidoformate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.581g/cm3 |
|---|---|
| Boiling Point | 418.8ºC at 760mmHg |
| Molecular Formula | C9H8Cl2N2O3 |
| Molecular Weight | 263.07700 |
| Flash Point | 207.1ºC |
| Exact Mass | 261.99100 |
| PSA | 81.92000 |
| LogP | 2.47690 |
| InChIKey | LUTUCNIKEYNGLK-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)Nc1cc(Cl)cc(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(3,5-dichloroph... CAS#:62584-33-2 |
| Literature: Mercadier, Christine; Vega, Danielle; Bastide, Jean FEMS Microbiology Ecology, 1997 , vol. 23, # 3 p. 207 - 215 |
|
~%
(3,5-dichloroph... CAS#:62584-33-2
Detail
Learn More
|
| Literature: Mercadier, Christine; Vega, Danielle; Bastide, Jean FEMS Microbiology Ecology, 1997 , vol. 23, # 3 p. 207 - 215 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:36734-17-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 263-612-9 |
| 2-[(3,5-dichlorophenyl)carbamoylamino]acetic acid |
| 3,5-dichlorophenylurea acetic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of (3,5-dichlorophenyl)ureidoformate? |
| A: Related upstream materials(CAS) of (3,5-dichlorophenyl)ureidoformate: 27387-87-7;36734-19-7. |
| Q: What is the InChIKey of (3,5-dichlorophenyl)ureidoformate? |
| A: InChIKey of (3,5-dichlorophenyl)ureidoformate is LUTUCNIKEYNGLK-UHFFFAOYSA-N. |
| Q: What English synonyms does (3,5-dichlorophenyl)ureidoformate have? |
| A: English synonyms of (3,5-dichlorophenyl)ureidoformate: EINECS 263-612-9, 2-[(3,5-dichlorophenyl)carbamoylamino]acetic acid, 3,5-dichlorophenylurea acetic acid. |
| Q: What is the boiling point of (3,5-dichlorophenyl)ureidoformate? |
| A: Boiling point of (3,5-dichlorophenyl)ureidoformate is 418.8ºC at 760mmHg. |
| Q: What is the SMILES notation of (3,5-dichlorophenyl)ureidoformate? |
| A: SMILES notation of (3,5-dichlorophenyl)ureidoformate is O=C(O)CNC(=O)Nc1cc(Cl)cc(Cl)c1. |
| Q: What is the LogP of (3,5-dichlorophenyl)ureidoformate? |
| A: LogP of (3,5-dichlorophenyl)ureidoformate is 2.47690. |
| Q: What is the CAS number of (3,5-dichlorophenyl)ureidoformate? |
| A: CAS number of (3,5-dichlorophenyl)ureidoformate is 62584-33-2. |
| Q: What is the molecular weight of (3,5-dichlorophenyl)ureidoformate? |
| A: Molecular weight of (3,5-dichlorophenyl)ureidoformate is 263.07700. |
| Q: What are the downstream products of (3,5-dichlorophenyl)ureidoformate? |
| A: Related downstream products(CAS) of (3,5-dichlorophenyl)ureidoformate: 36734-19-7;626-43-7;36734-17-5. |
| Q: What is the English name of (3,5-dichlorophenyl)ureidoformate? |
| A: The English name of (3,5-dichlorophenyl)ureidoformate is (3,5-dichlorophenyl)ureidoformate. |