1,3-Dibenzoylpropane structure
|
Common Name | 1,3-Dibenzoylpropane | ||
|---|---|---|---|---|
| CAS Number | 6263-83-8 | Molecular Weight | 252.30800 | |
| Density | 1.097g/cm3 | Boiling Point | 421.7ºC at 760 mmHg | |
| Molecular Formula | C17H16O2 | Melting Point | 66-68ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 157.7ºC | |
| Name | 1,5-diphenyl-1,5-pentanedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 421.7ºC at 760 mmHg |
| Melting Point | 66-68ºC(lit.) |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.30800 |
| Flash Point | 157.7ºC |
| Exact Mass | 252.11500 |
| PSA | 34.14000 |
| LogP | 3.92250 |
| Index of Refraction | 1.567 |
| InChIKey | YOLLTWVIOASMFW-UHFFFAOYSA-N |
| SMILES | O=C(CCCC(=O)c1ccccc1)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Electrochemical cyclization: II. Intramolecular pinacolization of 1, 3-dibenzoylpropane in acetonitrile. Ammar F, et al.
J. Electroanal. Chem. Interfac. Electrochem. 53(3) , 407-16, (1974)
|
|
|
Highly selective aldol reaction of dibenzoylmethanes with formaldehyde catalyzed by cobalt Schiff base complex under neutral conditions. Maruyama K, et al.
Tetrahedron Lett. 36(31) , 5609-12, (1995)
|
| 1,5-diphenylpentane-1,5-dione |