Dabcyl acid structure
|
Common Name | Dabcyl acid | ||
|---|---|---|---|---|
| CAS Number | 6268-49-1 | Molecular Weight | 269.29900 | |
| Density | 1.17g/cm3 | Boiling Point | 482.6ºC at 760 mmHg | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.6ºC | |
Use of Dabcyl acidDabcyl acid (Dabcyl) is the original dark fluorescence quencher. |
| Name | Para Methyl Red |
|---|---|
| Synonym | More Synonyms |
| Description | Dabcyl acid (Dabcyl) is the original dark fluorescence quencher. |
|---|---|
| Related Catalog |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 482.6ºC at 760 mmHg |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.29900 |
| Flash Point | 245.6ºC |
| Exact Mass | 269.11600 |
| PSA | 65.26000 |
| LogP | 3.86620 |
| Index of Refraction | 1.592 |
| InChIKey | WCKQPPQRFNHPRJ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2ccc(C(=O)O)cc2)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2927000090 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid |