bis(2,2,2-trichloroethyl) (E)-but-2-enedioate structure
|
Common Name | bis(2,2,2-trichloroethyl) (E)-but-2-enedioate | ||
|---|---|---|---|---|
| CAS Number | 6270-21-9 | Molecular Weight | 378.84900 | |
| Density | 1.65g/cm3 | Boiling Point | 414.8ºC at 760 mmHg | |
| Molecular Formula | C8H6Cl6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | bis(2,2,2-trichloroethyl) (E)-but-2-enedioate |
|---|
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 414.8ºC at 760 mmHg |
| Molecular Formula | C8H6Cl6O4 |
| Molecular Weight | 378.84900 |
| Flash Point | 164.3ºC |
| Exact Mass | 375.84000 |
| PSA | 52.60000 |
| LogP | 3.36940 |
| Index of Refraction | 1.537 |
| InChIKey | WFTACGQPAJJUOO-OWOJBTEDSA-N |
| SMILES | O=C(C=CC(=O)OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
|
~%
bis(2,2,2-trich... CAS#:6270-21-9 |
| Literature: Hill Journal of the American Chemical Society, 1954 , vol. 76, p. 2329,2330 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |