1-Naphthalenesulfonylchloride, 5-chloro- structure
|
Common Name | 1-Naphthalenesulfonylchloride, 5-chloro- | ||
|---|---|---|---|---|
| CAS Number | 6291-07-2 | Molecular Weight | 261.12400 | |
| Density | 1.516g/cm3 | Boiling Point | 375.4ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2O2S | Melting Point | 94-95ºC | |
| MSDS | USA | Flash Point | 180.9ºC | |
| Name | 5-Chloronaphthalene-1-sulfonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 375.4ºC at 760 mmHg |
| Melting Point | 94-95ºC |
| Molecular Formula | C10H6Cl2O2S |
| Molecular Weight | 261.12400 |
| Flash Point | 180.9ºC |
| Exact Mass | 259.94700 |
| PSA | 42.52000 |
| LogP | 4.50150 |
| Index of Refraction | 1.649 |
| InChIKey | ZELWQFZGPMGHRI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc2c(Cl)cccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2904909090 |
|
~60%
1-Naphthalenesu... CAS#:6291-07-2 |
| Literature: Liu, Hong; Gao, Zhao-Bing; Yao, Zhiyi; Zheng, Suxin; Li, Yang; Zhu, Weiliang; Tan, Xiaojian; Luo, Xiaomin; Shen, Jianhua; Chen, Kaixian; Hu, Guo-Yuan; Jiang, Hualiang Journal of Medicinal Chemistry, 2007 , vol. 50, # 1 p. 83 - 93 |
|
~%
1-Naphthalenesu... CAS#:6291-07-2 |
| Literature: Skopp; Schwenker Archiv der Pharmazie, 1984 , vol. 317, # 7 p. 649 - 650 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-Chlor-naphthalin-1-sulfonylchlorid |
| 5-chloro-1-naphthalenesulfonyl chloride |
| 5-chloro-naphthalene-1-sulfonyl chloride |
| OR7100T |
| 5-chloro-naphthalene-1-sulphonyl chloride |
| 5-Chlor-1-naphthalinsulfonylchlorid |
| 5-chloronaphthalene sulfonylchloride |