Alanine, N-(thiocarboxy)-,S-benzyl ester, L- (8CI)
Modify Date: 2025-09-19 14:28:20
Alanine, N-(thiocarboxy)-,S-benzyl ester, L- (8CI) structure
|
Common Name | Alanine, N-(thiocarboxy)-,S-benzyl ester, L- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 6297-75-2 | Molecular Weight | 239.29100 | |
| Density | 1.281g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(benzylsulfanylcarbonylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.29100 |
| Exact Mass | 239.06200 |
| PSA | 91.70000 |
| LogP | 2.49340 |
| Index of Refraction | 1.588 |
| InChIKey | QRQAUDOFQQQIGA-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)SCc1ccccc1)C(=O)O |
|
~%
Alanine, N-(thi... CAS#:6297-75-2 |
| Literature: Kollonitsch et al. Chemische Berichte, 1956 , vol. 89, p. 2288,2290 |
|
~%
Alanine, N-(thi... CAS#:6297-75-2 |
| Literature: Kollonitsch et al. Chemische Berichte, 1956 , vol. 89, p. 2288,2290 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| N-Benzylthiocarbonyl-glycin |
| N-benzylsulfanylcarbonyl-L-alanine |
| N-Benzylmercaptocarbonyl-L-alanin |
| N-benzylsulfanylcarbonyl-glycine |
| Benzylmercaptocarbonylamino-essigsaeure |
| N-Benzylmercaptocarbonyl-glycin |
| N-Benzylmercaptocarbonyl-D,L-leucin |