Piperazine,1,4-bis(2-bromo-1-oxobutyl)- (9CI) structure
|
Common Name | Piperazine,1,4-bis(2-bromo-1-oxobutyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6303-01-1 | Molecular Weight | 384.10700 | |
| Density | 1.572g/cm3 | Boiling Point | 469.8ºC at 760 mmHg | |
| Molecular Formula | C12H20Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238ºC | |
| Name | 2-bromo-1-[4-(2-bromobutanoyl)piperazin-1-yl]butan-1-one |
|---|
| Density | 1.572g/cm3 |
|---|---|
| Boiling Point | 469.8ºC at 760 mmHg |
| Molecular Formula | C12H20Br2N2O2 |
| Molecular Weight | 384.10700 |
| Flash Point | 238ºC |
| Exact Mass | 381.98900 |
| PSA | 40.62000 |
| LogP | 1.88000 |
| Index of Refraction | 1.55 |
| InChIKey | RTTJQPAFSDHAOH-UHFFFAOYSA-N |
| SMILES | CCC(Br)C(=O)N1CCN(C(=O)C(Br)CC)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |