Isobenzofuran,1,3-bis(4-methoxyphenyl)- structure
|
Common Name | Isobenzofuran,1,3-bis(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6306-97-4 | Molecular Weight | 330.37700 | |
| Density | 1.159g/cm3 | Boiling Point | 498.1ºC at 760 mmHg | |
| Molecular Formula | C22H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.8ºC | |
| Name | 1,3-bis(4-methoxyphenyl)-2-benzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 498.1ºC at 760 mmHg |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.37700 |
| Flash Point | 265.8ºC |
| Exact Mass | 330.12600 |
| PSA | 31.60000 |
| LogP | 5.78400 |
| Index of Refraction | 1.611 |
| InChIKey | CNTRLEAHTOEKFL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc(-c3ccc(OC)cc3)c3ccccc23)cc1 |
| HS Code | 2932999099 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-bis-(4-methoxy-phenyl)-isobenzofuran |