(2,4-dimethylphenyl) N,N-dimethylcarbamate structure
|
Common Name | (2,4-dimethylphenyl) N,N-dimethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 6316-05-8 | Molecular Weight | 193.24200 | |
| Density | 1.053g/cm3 | Boiling Point | 277.9ºC at 760 mmHg | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.9ºC | |
| Name | (2,4-dimethylphenyl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.053g/cm3 |
|---|---|
| Boiling Point | 277.9ºC at 760 mmHg |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.24200 |
| Flash Point | 121.9ºC |
| Exact Mass | 193.11000 |
| PSA | 29.54000 |
| LogP | 2.36380 |
| Index of Refraction | 1.518 |
| InChIKey | RJGHPIMYXPOTHB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(=O)N(C)C)c(C)c1 |
|
~%
(2,4-dimethylph... CAS#:6316-05-8 |
| Literature: Zhao, Xiaodan; Yeung, Charles S.; Dong, Vy M. Journal of the American Chemical Society, 2010 , vol. 132, # 16 p. 5837 - 5844 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-dimethylphenyl dimethylcarbamate |