(2,4,5-trichlorophenyl) N,N-dimethylcarbamate structure
|
Common Name | (2,4,5-trichlorophenyl) N,N-dimethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 6935-06-4 | Molecular Weight | 268.52400 | |
| Density | 1.438g/cm3 | Boiling Point | 336.2ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.1ºC | |
| Name | (2,4,5-trichlorophenyl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 336.2ºC at 760 mmHg |
| Molecular Formula | C9H8Cl3NO2 |
| Molecular Weight | 268.52400 |
| Flash Point | 157.1ºC |
| Exact Mass | 266.96200 |
| PSA | 29.54000 |
| LogP | 3.70720 |
| Index of Refraction | 1.563 |
| InChIKey | VCSDFCWFZZFAEC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Oc1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
(2,4,5-trichlor... CAS#:6935-06-4 |
| Literature: Soc. Usines Chim. Rhone-Poulenc Patent: GB753766 , 1954 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-DIMETHYL-2,4,5-TRICHLOROPHENYL CARBAMATE |
| 2,4,5-Trichlorophenyl-N,N-dimethyl carbamate |