4-(6-methoxytetralin-1-yl)butanoic acid structure
|
Common Name | 4-(6-methoxytetralin-1-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6317-48-2 | Molecular Weight | 248.31700 | |
| Density | 1.101g/cm3 | Boiling Point | 425.9ºC at 760 mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | 4-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butanoic acid |
|---|
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 425.9ºC at 760 mmHg |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.31700 |
| Flash Point | 158.3ºC |
| Exact Mass | 248.14100 |
| PSA | 46.53000 |
| LogP | 3.37000 |
| Index of Refraction | 1.532 |
| InChIKey | WEMUCYXLCOCBPN-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CCCC2CCCC(=O)O |
|
~%
4-(6-methoxytet... CAS#:6317-48-2 |
| Literature: Stork Journal of the American Chemical Society, 1947 , vol. 69, p. 2936,2939 |
|
~%
4-(6-methoxytet... CAS#:6317-48-2 |
| Literature: Stork Journal of the American Chemical Society, 1947 , vol. 69, p. 2936,2939 |
|
~%
4-(6-methoxytet... CAS#:6317-48-2 |
| Literature: Haberland Chemische Berichte, 1936 , vol. 69, p. 1380,1383 |
|
~%
4-(6-methoxytet... CAS#:6317-48-2 |
| Literature: Haberland Chemische Berichte, 1936 , vol. 69, p. 1380,1383 |