Gabazine free base structure
|
Common Name | Gabazine free base | ||
|---|---|---|---|---|
| CAS Number | 105538-73-6 | Molecular Weight | 368.22600 | |
| Density | 1.25g/cm3 | Boiling Point | 474.4ºC at 760 mmHg | |
| Molecular Formula | C15H18BrN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.7ºC | |
Use of Gabazine free baseGabazine free base is a specific GABA receptor antagonist. Does not affect GABA-transaminase or glutamate-decarboxylase activitites. |
| Name | 4-[6-imino-3-(4-methoxyphenyl)pyridazin-1-yl]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 474.4ºC at 760 mmHg |
| Molecular Formula | C15H18BrN3O3 |
| Molecular Weight | 368.22600 |
| Flash Point | 240.7ºC |
| Exact Mass | 367.05300 |
| PSA | 88.20000 |
| LogP | 2.96080 |
| Vapour Pressure | 8.33E-10mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | ACVGNKYJVGNLIL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(=N)n(CCCC(=O)O)n2)cc1 |
| Tocris-1262 |