butyl 2-amino-3-phenyl-propanoate structure
|
Common Name | butyl 2-amino-3-phenyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 6330-15-0 | Molecular Weight | 257.75600 | |
| Density | 1.042g/cm3 | Boiling Point | 314.5ºC at 760 mmHg | |
| Molecular Formula | C13H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | butyl 2-amino-3-phenylpropanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 314.5ºC at 760 mmHg |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.75600 |
| Flash Point | 167.2ºC |
| Exact Mass | 257.11800 |
| PSA | 52.32000 |
| LogP | 3.40200 |
| Index of Refraction | 1.517 |
| InChIKey | XHOFZUILKVVMBK-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(N)Cc1ccccc1.Cl |
|
~58%
butyl 2-amino-3... CAS#:6330-15-0 |
| Literature: Willemen, Hendra M.; Vermonden, Tina; Marcelis, Antonius T. M.; Sudhoelter, Ernst J. R. European Journal of Organic Chemistry, 2001 , # 12 p. 2329 - 2335 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| L-Phenylalanin-butylester*HCl |
| L-phenylalanine n-butyl ester hydrochloride |
| L-Phe-OBu*HCl |
| L-phenylalanine butyl ester hydrochloride |