GTC 365 hydrochloride structure
|
Common Name | GTC 365 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 63345-17-5 | Molecular Weight | 529.99900 | |
| Density | 1.51g/cm3 | Boiling Point | 745.8ºC at 760 mmHg | |
| Molecular Formula | C23H24ClN7O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 404.8ºC | |
Use of GTC 365 hydrochlorideGTC-365 (NSC 177365) is a small drug-like pharmacological chaperone that induces cancer cell death by restoring tertiary DNA structures in mutant human telomerase reverse transcriptase (hTERT) promoters. |
| Name | 2-[3-[[4-[(3-nitroacridin-9-yl)amino]phenyl]sulfamoyl]propyl]guanidine,hydrochloride |
|---|
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 745.8ºC at 760 mmHg |
| Molecular Formula | C23H24ClN7O4S |
| Molecular Weight | 529.99900 |
| Flash Point | 404.8ºC |
| Exact Mass | 529.13000 |
| PSA | 187.19000 |
| LogP | 7.39760 |
| Index of Refraction | 1.726 |
| InChIKey | ZBXXIEYBGSMVKQ-UHFFFAOYSA-N |
| SMILES | NC(N)=NCCCS(=O)(=O)Nc1ccc(Nc2c3ccccc3nc3cc([N+](=O)[O-])ccc23)cc1 |