2-bromo-N,N-diphenyl-acetamide structure
|
Common Name | 2-bromo-N,N-diphenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 6335-34-8 | Molecular Weight | 290.15500 | |
| Density | 1.51g/cm3 | Boiling Point | 579.8ºC at 760 mmHg | |
| Molecular Formula | C14H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.4ºC | |
| Name | N,N-diphenyltriflamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 579.8ºC at 760 mmHg |
| Molecular Formula | C14H12BrNO |
| Molecular Weight | 290.15500 |
| Flash Point | 304.4ºC |
| Exact Mass | 289.01000 |
| PSA | 20.31000 |
| LogP | 3.74620 |
| Index of Refraction | 1.706 |
| InChIKey | CIGSKJKGTWNQAX-UHFFFAOYSA-N |
| SMILES | O=C(CBr)N(c1ccccc1)c1ccccc1 |
|
~42%
2-bromo-N,N-dip... CAS#:6335-34-8 |
| Literature: McAllister, Laura A.; Turner, Kristy L.; Brand, Stephen; Stefaniak, Mark; Procter, David J. Journal of Organic Chemistry, 2006 , vol. 71, # 17 p. 6497 - 6507 |
|
~84%
2-bromo-N,N-dip... CAS#:6335-34-8 |
| Literature: Kleiner, Thomas; Bongardt, Frank; Voegtle, Fritz; Laeubli, Markus Werner; Dinten, Oliver; Simon, Wilhelm Chemische Berichte, 1985 , vol. 118, # 3 p. 1071 - 1077 |
| 2-bromo-N,N-diphenyl acetamide |
| Methanesulfonamide,1,1,1-trifluoro-N,N-diphenyl |
| 2-Brom-N,N-diphenylacetamid |
| N,N-diphenyltrifluoromethanesulfonamide |