Benzene,1-methoxy-4-(4-nitrophenoxy) structure
|
Common Name | Benzene,1-methoxy-4-(4-nitrophenoxy) | ||
|---|---|---|---|---|
| CAS Number | 6337-24-2 | Molecular Weight | 245.23100 | |
| Density | 1.252g/cm3 | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.5ºC | |
| Name | 1-(4-methoxyphenoxy)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760 mmHg |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23100 |
| Flash Point | 155.5ºC |
| Exact Mass | 245.06900 |
| PSA | 64.28000 |
| LogP | 3.91890 |
| Index of Refraction | 1.588 |
| InChIKey | NBCQLWNLTLMGCB-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| p-OMeC6H4OH4C6NO2-p |
| 4-Nitrophenyl 4-methoxyphenyl ether |
| Einecs 228-722-3 |
| 4-Methoxyphenyl 4-nitrophenyl ether |
| 4-Nitro-4'-methoxydiphenyl ether |
| p-methoxyphenyl p-nitrophenyl ether |