Ether,bis[bis(p-nitrophenyl)methyl] (8CI) structure
|
Common Name | Ether,bis[bis(p-nitrophenyl)methyl] (8CI) | ||
|---|---|---|---|---|
| CAS Number | 6337-32-2 | Molecular Weight | 530.44300 | |
| Density | 1.455g/cm3 | Boiling Point | 720ºC at 760mmHg | |
| Molecular Formula | C26H18N4O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.8ºC | |
| Name | 1-[bis(4-nitrophenyl)methoxy-(4-nitrophenyl)methyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 720ºC at 760mmHg |
| Molecular Formula | C26H18N4O9 |
| Molecular Weight | 530.44300 |
| Flash Point | 277.8ºC |
| Exact Mass | 530.10700 |
| PSA | 192.51000 |
| LogP | 8.30780 |
| Index of Refraction | 1.675 |
| InChIKey | CFNBBYGSZCDSGF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(OC(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
Ether,bis[bis(p... CAS#:6337-32-2 |
| Literature: Curtin; Leskowitz Journal of the American Chemical Society, 1951 , vol. 73, p. 2630,2632 |
|
~%
Ether,bis[bis(p... CAS#:6337-32-2 |
| Literature: Curtin; Leskowitz Journal of the American Chemical Society, 1951 , vol. 73, p. 2630,2632 |
|
~%
Ether,bis[bis(p... CAS#:6337-32-2 |
| Literature: Gorvin Journal of the Chemical Society, 1955 , p. 83,86 |
|
~%
Ether,bis[bis(p... CAS#:6337-32-2 |
| Literature: Gorvin Journal of the Chemical Society, 1955 , p. 83,86 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bis-(4,4'-dinitro-benzhydryl)-aether |
| 4,4,4',4'-Tetramethyl-benzophenon-azin |
| Bis-(4,4'-dimethyl-benzhydryliden)-hydrazin |
| bis-(4,4'-dimethyl-benzhydrylidene)-hydrazine |
| p,p'-Dimethylbenzophenon-azin |
| bis-(4,4'-dinitro-benzhydryl)-ether |
| Bis(di-p-tolylmethylene)hydrazine |
| 4.4'-Dimethyl-diphenylketazin |
| Di-p-tolyl-ketazin |
| p,p'-Dimethyl-benzophenon-ozin |