1-[bromo-(4-nitrophenyl)methyl]-4-nitro-benzene structure
|
Common Name | 1-[bromo-(4-nitrophenyl)methyl]-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 5397-83-1 | Molecular Weight | 337.12600 | |
| Density | 1.632g/cm3 | Boiling Point | 472.3ºC at 760 mmHg | |
| Molecular Formula | C13H9BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.5ºC | |
| Name | 1-[bromo-(4-nitrophenyl)methyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.632g/cm3 |
|---|---|
| Boiling Point | 472.3ºC at 760 mmHg |
| Molecular Formula | C13H9BrN2O4 |
| Molecular Weight | 337.12600 |
| Flash Point | 239.5ºC |
| Exact Mass | 335.97500 |
| PSA | 91.64000 |
| LogP | 5.03370 |
| Index of Refraction | 1.661 |
| InChIKey | DSTCKYXFMAENQF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(Br)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-[bromo-(4-nit... CAS#:5397-83-1 |
| Literature: Gorvin Journal of the Chemical Society, 1955 , p. 83,86 |
|
~%
1-[bromo-(4-nit... CAS#:5397-83-1 |
| Literature: Orazi; Giunti Anales de la Asociacion Quimica Argentina (1921-2001), 1951 , vol. 39, p. 84,89 |
| 4,4'-Dinitrobenzhydrylbromid |
| Brom-bis-(4-nitro-phenyl)-methan |
| bromo-bis-(4-nitro-phenyl)-methane |
| Brom-bis-(4-hydroxy-3-nitro-phenyl)-arsin |
| bromo-bis-(4-hydroxy-3-nitro-phenyl)-arsine |