Ceratamine A structure
|
Common Name | Ceratamine A | ||
|---|---|---|---|---|
| CAS Number | 634151-15-8 | Molecular Weight | 468.14300 | |
| Density | 1.722g/cm3 | Boiling Point | 543.271ºC at 760 mmHg | |
| Molecular Formula | C17H16Br2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.36ºC | |
Use of Ceratamine ACeratamine A is an antimitotic heterocyclic alkaloid isolated from the marine sponge Pseudoceratina sp., acts as a microtubule-stabilizing agent. Ceratamine A exhibits cytotoxicity against human cancer cell lines[1][2][3]. |
| Name | 4-[(3,5-dibromo-4-methoxyphenyl)methyl]-6-methyl-2-(methylamino)imidazo[4,5-d]azepin-5-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ceratamine A is an antimitotic heterocyclic alkaloid isolated from the marine sponge Pseudoceratina sp., acts as a microtubule-stabilizing agent. Ceratamine A exhibits cytotoxicity against human cancer cell lines[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.722g/cm3 |
|---|---|
| Boiling Point | 543.271ºC at 760 mmHg |
| Molecular Formula | C17H16Br2N4O2 |
| Molecular Weight | 468.14300 |
| Flash Point | 282.36ºC |
| Exact Mass | 465.96400 |
| PSA | 69.04000 |
| LogP | 3.56760 |
| Index of Refraction | 1.683 |
| InChIKey | HAIJSTYZBPUVSG-UHFFFAOYSA-N |
| SMILES | CNc1nc2ccn(C)c(=O)c(Cc3cc(Br)c(OC)c(Br)c3)c-2n1 |
| CERATAMINE A |
| 4-[(3,5-Dibromo-4-methoxyphenyl)methyl]-6-methyl-2-(methylamino)imidazo[4,5-d]azepin-5(6H)-one |
| 4-(3,5-dibromo-4-methoxybenzyl)-6-methyl-2-(methylamino)imidazo[4,5-d]azepin-5(6H)-one |