3-nitrophthalic acid, compound with pyridine (1:1) structure
|
Common Name | 3-nitrophthalic acid, compound with pyridine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 63451-32-1 | Molecular Weight | 290.22800 | |
| Density | N/A | Boiling Point | 441.3ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 3-nitrophthalic acid,pyridine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 441.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.22800 |
| Flash Point | 199.4ºC |
| Exact Mass | 290.05400 |
| PSA | 133.31000 |
| LogP | 2.59600 |
| InChIKey | BEUKKBRRUALXBQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O.c1ccncc1 |
| 3-Nitrophthalic acid,compound with pyridine (1:1) |
| EINECS 264-194-0 |
| Pyridinium 3-nitrophthalate |
| 3-nitrophthalic acid-pyridine(1:1) |