Merck SIP Agonist structure
|
Common Name | Merck SIP Agonist | ||
|---|---|---|---|---|
| CAS Number | 635701-59-6 | Molecular Weight | 391.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Merck SIP AgonistCAY10734 is an agonist of sphingosine-1-phosphate receptor 1 (S1P1). It selectively binds S1P1 over S1P2, S1P3, and S1P4 receptors but does also bind S1P5 receptors in radioligand binding assays. CAY10734 reduces peripheral blood lymphocytes and increases graft survival in a rat skin allograft model combination with cyclosporin A (CsA). |
| Name | 1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H25N3O3 |
|---|---|
| Molecular Weight | 391.46300 |
| Exact Mass | 391.19000 |
| PSA | 79.46000 |
| LogP | 4.05640 |
| InChIKey | SHQNRSGKLNMHOS-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1ccc(-c2nc(-c3ccc(CN4CC(C(=O)O)C4)cc3)no2)cc1 |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,4-oxadiazole_based compound 26 |
| cc-147 |
| Merck SIP Agonist |