4-Aminophenol-2,6-disulfonic acid structure
|
Common Name | 4-Aminophenol-2,6-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6362-53-4 | Molecular Weight | 269.25200 | |
| Density | 1.333g/cm3 | Boiling Point | 615.3ºC at 760 mmHg | |
| Molecular Formula | C6H7NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.9ºC | |
| Name | 4-Aminophenol-2,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 615.3ºC at 760 mmHg |
| Molecular Formula | C6H7NO7S2 |
| Molecular Weight | 269.25200 |
| Flash Point | 325.9ºC |
| Exact Mass | 268.96600 |
| PSA | 171.75000 |
| LogP | 2.21060 |
| Index of Refraction | 1.632 |
| InChIKey | NUSPZLUAPAWUPZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)COc1ccc(Cl)cc1 |
| HS Code | 2922299090 |
|---|
|
~%
4-Aminophenol-2... CAS#:6362-53-4 |
| Literature: Wilsing Justus Liebigs Annalen der Chemie, 1882 , vol. 215, p. 229,236 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-aminosalicylic acid methyl ester |
| Methyl 5-aminosalicylate |
| 5-amino-2-hydroxy-benzoic acid methyl ester |
| 5-Amino-2-hydroxy-benzol-1,3-disulfonsaeure |
| 5-amino-2-hydroxy-benzene-1,3-disulfonic acid |
| Salicylic acid,5-amino-,methyl ester |
| 5-Aminomethylsalicylic acid |
| 3-amino-6-hydroxy-benzoic acid methyl ester |
| Methyl m-aminosalicylate |