2,6-Naphthalenedisulfonicacid, 4-amino- structure
|
Common Name | 2,6-Naphthalenedisulfonicacid, 4-amino- | ||
|---|---|---|---|---|
| CAS Number | 6362-05-6 | Molecular Weight | 303.31200 | |
| Density | 1.769g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-aminonaphthalene-2,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.769g/cm3 |
|---|---|
| Molecular Formula | C10H9NO6S2 |
| Molecular Weight | 303.31200 |
| Exact Mass | 302.98700 |
| PSA | 151.52000 |
| LogP | 3.65820 |
| Index of Refraction | 1.733 |
| InChIKey | XGQWHHCZIMXNHG-UHFFFAOYSA-N |
| SMILES | Nc1cc(S(=O)(=O)O)cc2ccc(S(=O)(=O)O)cc12 |
| HS Code | 2921499090 |
|---|
|
~%
2,6-Naphthalene... CAS#:6362-05-6 |
|
Literature: Freund Patent: DE27346 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 431 Full Text Show Details Taeuber; Norman Die Derivate des Naphthalins |
|
~%
2,6-Naphthalene... CAS#:6362-05-6 |
| Literature: Bayer and Co. Patent: DE255724 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 217 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-amino-3,7-naphthalenedisulfonic acid |
| 4-Amino-naphthalin-2,6-disulfonsaeure |
| 4-amino-naphthalene-2,6-disulfonic acid |
| 2,4-amino |
| 1-naphthylamine-3,7-disulfonic acid |