Z-Gly-Nva-OH structure
|
Common Name | Z-Gly-Nva-OH | ||
|---|---|---|---|---|
| CAS Number | 63623-57-4 | Molecular Weight | 308.33000 | |
| Density | 1.228g/cm3 | Boiling Point | 584ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307ºC | |
| Name | 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoic acid |
|---|
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 584ºC at 760 mmHg |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33000 |
| Flash Point | 307ºC |
| Exact Mass | 308.13700 |
| PSA | 104.73000 |
| LogP | 2.06410 |
| Index of Refraction | 1.539 |
| InChIKey | JOFRPFCSEYMUTH-UHFFFAOYSA-N |
| SMILES | CCCC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
Z-Gly-Nva-OH CAS#:63623-57-4 |
| Literature: Kosmynin, V. V.; Kaida, L. N.; Savelova, V. A.; Taran, N. A. Journal of Organic Chemistry USSR (English Translation), 1987 , vol. 23, p. 2306 - 2311 Zhurnal Organicheskoi Khimii, 1987 , vol. 23, # 12 p. 2612 - 2617 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |