1-(4-Isopropylphenyl)-5-oxopyrrolidine-3-carboxylic acid structure
|
Common Name | 1-(4-Isopropylphenyl)-5-oxopyrrolidine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 63674-51-1 | Molecular Weight | 247.29000 | |
| Density | 1.219g/cm3 | Boiling Point | 504.2ºC at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-oxo-1-(4-propan-2-ylphenyl)pyrrolidine-3-carboxylic acid |
|---|
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 504.2ºC at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29000 |
| Exact Mass | 247.12100 |
| PSA | 57.61000 |
| LogP | 2.31250 |
| Index of Refraction | 1.573 |
| InChIKey | DIVQVOIDVFIFAP-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(N2CC(C(=O)O)CC2=O)cc1 |
| HS Code | 2933790090 |
|---|
|
~82%
1-(4-Isopropylp... CAS#:63674-51-1 |
| Literature: Watanabe, S.; Ogawa, K.; Ohno, T.; Yano, S.; Yamada, H.; Shirasaka, T. European Journal of Medicinal Chemistry, 1994 , vol. 29, # 9 p. 675 - 686 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |