5-Amino-2-ethoxy-benzenesulfonic acid
5-Amino-2-ethoxy-benzenesulfonic acid structure
|
Common Name | 5-Amino-2-ethoxy-benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6375-02-6 | Molecular Weight | 217.24200 | |
| Density | 1.35g/cm3 | Boiling Point | 596.3ºC at 760 mmHg | |
| Molecular Formula | C8H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.4ºC | |
Summary: 5-Amino-2-ethoxybenzenesulfonic acid (CAS: 6375-02-6), molecular formula C8H11NO4S, molecular weight 217.24200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-amino-2-ethoxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 596.3ºC at 760 mmHg |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.24200 |
| Flash Point | 314.4ºC |
| Exact Mass | 217.04100 |
| PSA | 98.00000 |
| LogP | 2.57620 |
| Index of Refraction | 1.637 |
| InChIKey | INESHSIZOSSOEI-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N)cc1S(=O)(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-Amino-2-ethox... CAS#:6375-02-6 |
| Literature: Hoffmann-La Roche and Co. Patent: DE98839 ; |
|
~%
5-Amino-2-ethox... CAS#:6375-02-6 |
| Literature: Cohn,G. Justus Liebigs Annalen der Chemie, 1899 , vol. 309, p. 233 |
|
~%
5-Amino-2-ethox... CAS#:6375-02-6 |
| Literature: Hoffmann-La Roche Patent: DE98839 ; |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Ethoxymetanilic acid |
| EINECS 228-929-9 |
| 5-AMINO-2-ETHOXY-BENZENESULFONIC ACID |
| Metanilic acid,6-ethoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: The English name of 5-amino-2-ethoxybenzenesulfonic acid is 5-amino-2-ethoxybenzenesulfonic acid. |
| Q: What is the LogP of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: LogP of 5-amino-2-ethoxybenzenesulfonic acid is 2.57620. |
| Q: What is the molecular formula of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: Molecular formula of 5-amino-2-ethoxybenzenesulfonic acid is C8H11NO4S. |
| Q: What is the InChIKey of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: InChIKey of 5-amino-2-ethoxybenzenesulfonic acid is INESHSIZOSSOEI-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: Polar surface area (PSA) of 5-amino-2-ethoxybenzenesulfonic acid is 98.00000. |
| Q: What is the boiling point of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: Boiling point of 5-amino-2-ethoxybenzenesulfonic acid is 596.3ºC at 760 mmHg. |
| Q: What English synonyms does 5-amino-2-ethoxybenzenesulfonic acid have? |
| A: English synonyms of 5-amino-2-ethoxybenzenesulfonic acid: 6-Ethoxymetanilic acid, EINECS 228-929-9, 5-AMINO-2-ETHOXY-BENZENESULFONIC ACID, Metanilic acid,6-ethoxy. |
| Q: What is the SMILES notation of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: SMILES notation of 5-amino-2-ethoxybenzenesulfonic acid is CCOc1ccc(N)cc1S(=O)(=O)O. |
| Q: What is the CAS number of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: CAS number of 5-amino-2-ethoxybenzenesulfonic acid is 6375-02-6. |
| Q: What is the molecular weight of 5-amino-2-ethoxybenzenesulfonic acid? |
| A: Molecular weight of 5-amino-2-ethoxybenzenesulfonic acid is 217.24200. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |