[(4-chloro-2-nitrophenyl)thio]acetic acid
![[(4-chloro-2-nitrophenyl)thio]acetic acid Structure](https://image.chemsrc.com/caspic/279/6375-61-7.png)
[(4-chloro-2-nitrophenyl)thio]acetic acid structure
|
Common Name | [(4-chloro-2-nitrophenyl)thio]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6375-61-7 | Molecular Weight | 247.65600 | |
| Density | 1.6g/cm3 | Boiling Point | 407.1ºC at 760 mmHg | |
| Molecular Formula | C8H6ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 407.1ºC at 760 mmHg |
| Molecular Formula | C8H6ClNO4S |
| Molecular Weight | 247.65600 |
| Flash Point | 200ºC |
| Exact Mass | 246.97100 |
| PSA | 108.42000 |
| LogP | 2.94810 |
| Index of Refraction | 1.651 |
| InChIKey | ANONGKPSZGTEJI-UHFFFAOYSA-N |
| SMILES | O=C(O)CSc1ccc(Cl)cc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[(4-chloro-2-ni... CAS#:6375-61-7 |
| Literature: Roe; McGeehee Journal of the American Chemical Society, 1948 , vol. 70, p. 1662 |
|
~%
[(4-chloro-2-ni... CAS#:6375-61-7 |
| Literature: Ponci,R. et al. Farmaco, Edizione Scientifica, 1964 , vol. 19, p. 356 - 376 |
|
~%
[(4-chloro-2-ni... CAS#:6375-61-7 |
| Literature: Pollak; Riesz; Kahane Monatshefte fuer Chemie, 1928 , vol. 49, p. 219 |
|
~%
[(4-chloro-2-ni... CAS#:6375-61-7 |
| Literature: Ponci,R. et al. Farmaco, Edizione Scientifica, 1964 , vol. 19, p. 356 - 376 |
|
~%
[(4-chloro-2-ni... CAS#:6375-61-7 |
| Literature: Roe; McGeehee Journal of the American Chemical Society, 1948 , vol. 70, p. 1662 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 6375-61-7? |
| A: Chinese name of 6375-61-7 is 6375-61-7. |
| Q: What is the English name of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: The English name of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid. |
| Q: What is the boiling point of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: Boiling point of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is 407.1ºC at 760 mmHg. |
| Q: What is the CAS number of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: CAS number of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is 6375-61-7. |
| Q: What is the InChIKey of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: InChIKey of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is ANONGKPSZGTEJI-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: LogP of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is 2.94810. |
| Q: What is the SMILES notation of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: SMILES notation of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is O=C(O)CSc1ccc(Cl)cc1[N+](=O)[O-]. |
| Q: What is the polar surface area (PSA) of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: Polar surface area (PSA) of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is 108.42000. |
| Q: What is the molecular weight of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: Molecular weight of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is 247.65600. |
| Q: What is the molecular formula of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid? |
| A: Molecular formula of 2-(4-chloro-2-nitrophenyl)sulfanylacetic acid is C8H6ClNO4S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |