10-hydroxystearic acid structure
|
Common Name | 10-hydroxystearic acid | ||
|---|---|---|---|---|
| CAS Number | 638-26-6 | Molecular Weight | 300.47700 | |
| Density | 0.944g/cm3 | Boiling Point | 436.3ºC at 760 mmHg | |
| Molecular Formula | C18H36O3 | Melting Point | 81-82 °C | |
| MSDS | N/A | Flash Point | 231.8ºC | |
| Name | (R)-10-hydroxystearic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.944g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760 mmHg |
| Melting Point | 81-82 °C |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.47700 |
| Flash Point | 231.8ºC |
| Exact Mass | 300.26600 |
| PSA | 57.53000 |
| LogP | 5.30330 |
| Index of Refraction | 1.468 |
| InChIKey | PAZZVPKITDJCPV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(O)CCCCCCCCC(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 10-Hydroxystearic acid |
| Octadecanoic acid,10-hydroxy |
| 10-hydroxyoctadecanoic acid |
| 10-hydroxy-octadecanoic acid |
| DL-10-hydroxy stearic acid |
| USDA 10-hydroxystearic acid |
| Rosilic acid |