Trans-3-benzyloxy-4-methoxy-beta-nitrostyrene structure
|
Common Name | Trans-3-benzyloxy-4-methoxy-beta-nitrostyrene | ||
|---|---|---|---|---|
| CAS Number | 63909-29-5 | Molecular Weight | 285.29500 | |
| Density | 1.212g/cm3 | Boiling Point | 450.5ºC at 760 mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | 128-131 °C(lit.) | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | TRANS-3-BENZYLOXY-4-METHOXY-β-NITROSTYRENE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 450.5ºC at 760 mmHg |
| Melting Point | 128-131 °C(lit.) |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 191.8ºC |
| Exact Mass | 285.10000 |
| PSA | 64.28000 |
| LogP | 4.04480 |
| Index of Refraction | 1.607 |
| InChIKey | JNMKPRLNICRRIV-MDZDMXLPSA-N |
| SMILES | COc1ccc(C=C[N+](=O)[O-])cc1OCc1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 9 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-benzyloxy-4-methoxy-b-nitrostyrene |
| 3-benzyloxy-4-methoxy-b-nitrovinylbenzene |
| MFCD00100844 |
| 3-benzyloxy-4-methoxy-nitrostyrene |