5-Bromo-8-nitroisoquinoline structure
|
Common Name | 5-Bromo-8-nitroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 63927-23-1 | Molecular Weight | 253.052 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 386.9±27.0 °C at 760 mmHg | |
| Molecular Formula | C9H5BrN2O2 | Melting Point | 136-140ºC | |
| MSDS | Chinese USA | Flash Point | 187.8±23.7 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 5-Bromo-8-nitroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.9±27.0 °C at 760 mmHg |
| Melting Point | 136-140ºC |
| Molecular Formula | C9H5BrN2O2 |
| Molecular Weight | 253.052 |
| Flash Point | 187.8±23.7 °C |
| Exact Mass | 251.953430 |
| PSA | 58.71000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | ULGOLOXWHJEZNZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Br)c2ccncc12 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R25;R37/38;R41 |
| Safety Phrases | S26-S39 |
| RIDADR | UN 2811 |
| HS Code | 2933499090 |
|
~98%
5-Bromo-8-nitro... CAS#:63927-23-1 |
| Literature: ABBOTT LABORATORIES Patent: WO2004/76424 A1, 2004 ; Location in patent: Page 174-175 ; WO 2004/076424 A1 |
|
~45%
5-Bromo-8-nitro... CAS#:63927-23-1 |
| Literature: Gomtsyan, Arthur; Bayburt, Erol K.; Schmidt, Robert G.; Guo, Zhu Zheng; Perner, Richard J.; Didomenico, Stanley; Koenig, John R.; Turner, Sean; Jinkerson, Tammie; Drizin, Irene; Hannick, Steven M.; Macri, Bryan S.; McDonald, Heath A.; Honore, Prisca; Wismer, Carol T.; Marsh, Kennan C.; Wetter, Jill; Stewart, Kent D.; Oie, Tetsuro; Jarvis, Michael F.; Surowy, Carol S.; Faltynek, Connie R.; Lee, Chih-Hung Journal of Medicinal Chemistry, 2005 , vol. 48, # 3 p. 744 - 752 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Isoquinoline, 5-bromo-8-nitro- |
| 5-Bromo-8-nitroisoquinoline |
| 5-bromo-8-nitro-isoquinoline |
| MFCD02091227 |
| 5-Brom-8-nitro-isochinolin |