2,2,3,3,3-Pentafluoropropyl p-Toluenesulfonate
Modify Date: 2026-07-01 12:08:31
2,2,3,3,3-Pentafluoropropyl p-Toluenesulfonate structure
|
Common Name | 2,2,3,3,3-Pentafluoropropyl p-Toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 565-42-4 | Molecular Weight | 304.23400 | |
| Density | 1.42g/cm3 | Boiling Point | 310.6ºC at 760 mmHg | |
| Molecular Formula | C10H9F5O3S | Melting Point | 53-54.5ºC | |
| MSDS | N/A | Flash Point | 141.7ºC | |
| Name | 1h,1h-pentafluoropropyl p-toluenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 310.6ºC at 760 mmHg |
| Melting Point | 53-54.5ºC |
| Molecular Formula | C10H9F5O3S |
| Molecular Weight | 304.23400 |
| Flash Point | 141.7ºC |
| Exact Mass | 304.01900 |
| PSA | 51.75000 |
| LogP | 3.97870 |
| Index of Refraction | 1.439 |
| InChIKey | JBHQQXONFHOEQU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)C(F)(F)F)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2905590090 |
|
~84%
2,2,3,3,3-Penta... CAS#:565-42-4 |
| Literature: WO2004/9528 A1, ; Page 27 ; |
|
~%
2,2,3,3,3-Penta... CAS#:565-42-4 |
| Literature: Journal of Organic Chemistry, , vol. 30, p. 4322 - 4324 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,2,3,3,3-pentafluoropropyl 4-methylbenzenesulfonate |