Sennidin A structure
|
Common Name | Sennidin A | ||
|---|---|---|---|---|
| CAS Number | 641-12-3 | Molecular Weight | 538.458 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 801.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C30H18O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 452.6±30.8 °C | |
Use of Sennidin ASennidin A, isolated from the leaves of Cassia angustifolia, inhibits HCV NS3 helicase, with an IC50 of 0.8 μM. Sennidin A induces phosphorylation of Akt and glucose transporter 4 (GLUT4) translocation. Sennidin A stimulates the glucose incorporation[1][2]. |
| Name | sennidine a |
|---|---|
| Synonym | More Synonyms |
| Description | Sennidin A, isolated from the leaves of Cassia angustifolia, inhibits HCV NS3 helicase, with an IC50 of 0.8 μM. Sennidin A induces phosphorylation of Akt and glucose transporter 4 (GLUT4) translocation. Sennidin A stimulates the glucose incorporation[1][2]. |
|---|---|
| Related Catalog | |
| References |
[2]. Daigo Abe, et al. Sennidin stimulates glucose incorporation in rat adipocytes. Life Sciences. 2006. |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 801.8±65.0 °C at 760 mmHg |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.458 |
| Flash Point | 452.6±30.8 °C |
| Exact Mass | 538.090027 |
| PSA | 189.66000 |
| LogP | 8.24 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.806 |
| InChIKey | JPMRHWLJLNKRTJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)c2c(c1)C(C1c3cccc(O)c3C(=O)c3c(O)cc(C(=O)O)cc31)c1cccc(O)c1C2=O |
| Storage condition | 2-8℃ |
| SENECIONINE(SH) |
| 1',1,8',8-Tetrahydroxy-10,10'-dihydroanthrone-3,3'-dicarboxylic acid |
| EINECS 211-371-5 |
| dihydroxydianthrone |
| (+)-4,5,4',5'-tetrahydroxy-10,10'-dioxo-9,10,9',10'-tetrahydro-[9,9']bianthryl-2,2'-dicarboxylic acid |
| 4,4',5,5'-Tetrahydroxy-10,10'-dioxo-9,9',10,10'-tetrahydro-9,9'-bianthracene-2,2'-dicarboxylic acid |
| (R*,R*)-(+)-9,9',10,10'-Tetrahydro-4,4',5,5'-tetrahydroxy-10,10'-dioxo(9,9'-bianthracene)-2,2'-dicarboxylic acid |
| [9,9'-Bianthracene]-2,2'-dicarboxylic acid, 9,9',10,10'-tetrahydro-4,4',5,5'-tetrahydroxy-10,10'-dioxo- |
| Sennidin A |
| (+)-4,5,4',5'-Tetrahydroxy-10,10'-dioxo-9,10,9',10'-tetrahydro-[9,9']bianthryl-2,2'-dicarbonsaeure |
| (+)-4.5.4'.5'-Tetrahydroxy-10.10'-dioxo-9.10.9'.10'-tetrahydro-[9.9']bianthryl-dicarbonsaeure-(2.2') |