3-(Methoxycarbonyl)-4-nitrobenzoic acid structure
|
Common Name | 3-(Methoxycarbonyl)-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 64152-09-6 | Molecular Weight | 225.155 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 415.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H7NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3±25.9 °C | |
| Name | 3-(Methoxycarbonyl)-4-nitrobenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.9±35.0 °C at 760 mmHg |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.155 |
| Flash Point | 205.3±25.9 °C |
| Exact Mass | 225.027344 |
| PSA | 109.42000 |
| LogP | 1.55 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | KRACQAXEQJJYLE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(=O)O)ccc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~%
3-(Methoxycarbo... CAS#:64152-09-6 |
| Literature: WO2012/59442 A2, ; Page/Page column 57 ; WO 2012/059442 A2 |
|
~%
3-(Methoxycarbo... CAS#:64152-09-6 |
| Literature: Monatshefte fuer Chemie, , vol. 41, p. 155 |
|
~%
3-(Methoxycarbo... CAS#:64152-09-6 |
| Literature: Monatshefte fuer Chemie, , vol. 41, p. 155 |
|
~%
3-(Methoxycarbo... CAS#:64152-09-6 |
| Literature: Monatshefte fuer Chemie, , vol. 41, p. 155 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Benzenedicarboxylic acid, 4-nitro-, 3-methyl ester |
| 3-(Methoxycarbonyl)-4-nitrobenzoic acid |
| 3-methoxycarbonyl-4-nitrobenzoic acid |