4-Nitro-m-xylene structure
|
Common Name | 4-Nitro-m-xylene | ||
|---|---|---|---|---|
| CAS Number | 89-87-2 | Molecular Weight | 151.163 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 244.1±9.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO2 | Melting Point | 7-9 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 107.2±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitro-1,3-dimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 244.1±9.0 °C at 760 mmHg |
| Melting Point | 7-9 °C(lit.) |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.163 |
| Flash Point | 107.2±0.0 °C |
| Exact Mass | 151.063324 |
| PSA | 45.82000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | BBUPBICWUURTNP-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1 |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Water Solubility | 133 mg/L (20 ºC) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36/37 |
| RIDADR | UN 1665 6.1/PG 2 |
| WGK Germany | 2 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 29042000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Determination of trace level genotoxic impurities in small molecule drug substances using conventional headspace gas chromatography with contemporary ionic liquid diluents and electron capture detection.
J. Chromatogr. A. 1361 , 217-28, (2014) Ionic liquids (ILs) were used as a new class of diluents for the analysis of two classes of genotoxic impurities (GTIs), namely, alkyl/aryl halides and nitro-aromatics, in small molecule drug substanc... |
|
|
Rhodium-catalyzed synthesis of 1-alkynylphosphine oxides from 1-alkynes and tetraphenylbiphosphine. Arisawa M, et al.
Tetrahedron Lett. 47(29) , 5211-5213, (2006)
|
| EINECS 201-947-4 |
| 4-Nitro-m-xylene |
| 2,4-Dimethyl-1-nitrobenzene |
| 4-Nitro-1,3-dimethylbenzene |
| MFCD00007169 |