akuammigine structure
|
Common Name | akuammigine | ||
|---|---|---|---|---|
| CAS Number | 642-17-1 | Molecular Weight | 352.43 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 524.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.7±30.1 °C | |
Use of akuammigineAkuammigine is an alkaloid that can be found in hook-bearing branch of Uncariarhynchophylla. Akuammigine is a is a very weak antagonist at pre- and postsynaptic α-adrenoceptor of the rat vas deferens[1][2]. |
| Name | Methyl 4-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Akuammigine is an alkaloid that can be found in hook-bearing branch of Uncariarhynchophylla. Akuammigine is a is a very weak antagonist at pre- and postsynaptic α-adrenoceptor of the rat vas deferens[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 524.0±50.0 °C at 760 mmHg |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 |
| Flash Point | 270.7±30.1 °C |
| Exact Mass | 352.178680 |
| PSA | 54.56000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | GRTOGORTSDXSFK-BMYCAMMWSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCc4c([nH]c5ccccc45)C3CC12 |
| Hazard Codes | Xi |
|---|
| 4-Acetoresorcinol |
| Methyl (3β,19α,20α)-19-methyl-16,17-didehydro-18-oxayohimban-16-carboxylate |
| 2',4'-dihydroxyacetophenone |
| 4-ACETYLRESORCINOL |
| Resoacetophenone |
| RESACETOPHENONE |
| akuammigine |
| Oxayohimban-16-carboxylic acid, 16,17-didehydro-19-methyl-, methyl ester, (3β,19α,20α)- |
| b-Resacetophenone |
| HyMechroMone |
| reserpiline |