7-trifluoromethyl-4-quinolinethiol structure
|
Common Name | 7-trifluoromethyl-4-quinolinethiol | ||
|---|---|---|---|---|
| CAS Number | 64415-07-2 | Molecular Weight | 229.22200 | |
| Density | 1.44g/cm3 | Boiling Point | 254.1ºC at 760 mmHg | |
| Molecular Formula | C10H6F3NS | Melting Point | 222-225ºC(lit.) | |
| MSDS | USA | Flash Point | 107.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 7-(trifluoromethyl)-1H-quinoline-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 254.1ºC at 760 mmHg |
| Melting Point | 222-225ºC(lit.) |
| Molecular Formula | C10H6F3NS |
| Molecular Weight | 229.22200 |
| Flash Point | 107.5ºC |
| Exact Mass | 229.01700 |
| PSA | 51.69000 |
| LogP | 3.54230 |
| Index of Refraction | 1.6 |
| InChIKey | DBWDEWRMEKXOFI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(=S)cc[nH]c2c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Evidence for a role of CETP in HDL remodeling and cholesterol efflux: role of cysteine 13 of CETP.
Biochim. Biophys. Acta 1831(11) , 1644-50, (2013) Cholesteryl ester transfer protein (CETP), a key regulator of high-density lipoprotein (HDL) metabolism, induces HDL remodeling by transferring lipids between apolipoprotein B-containing lipoproteins ... |
| DBWDEWRMEKXOFI-UHFFFAOYSA |
| 4-mercapto 7-trifluoromethyl quinoline |
| 7-trifluoromethylquinolin-4-thiol |
| 7-(Trifluoromethyl)quinoline-4-thiol |
| 7-Trifluoromethyl-4-quinolinethiol |