2-Hydroxy-1-(4-nitrophenyl)-1-ethanone structure
|
Common Name | 2-Hydroxy-1-(4-nitrophenyl)-1-ethanone | ||
|---|---|---|---|---|
| CAS Number | 64611-67-2 | Molecular Weight | 181.14500 | |
| Density | 1.39g/cm3 | Boiling Point | 338.4ºC at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 140-143ºC | |
| MSDS | N/A | Flash Point | 152.6ºC | |
| Name | 2-hydroxy-1-(4-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 338.4ºC at 760 mmHg |
| Melting Point | 140-143ºC |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.14500 |
| Flash Point | 152.6ºC |
| Exact Mass | 181.03800 |
| PSA | 83.12000 |
| LogP | 1.29300 |
| Index of Refraction | 1.596 |
| InChIKey | DRGHCHSDUDQWHJ-UHFFFAOYSA-N |
| SMILES | O=C(CO)c1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-hydroxy-1-(4-nitrophenyl)-ethanone |
| 2-hydroxy-1-(4-nitrophenyl)ethan-1-one |
| 2-hydroxy-1-(4-nitrophenyl)-1-ethanone |
| 2-Hydroxy-1-(4-nitro-phenyl)-aethanon |
| 2-hydroxy-4'-nitroacetophenone |