(D-Phe7)-Somatostatin-14
Modify Date: 2025-08-25 17:37:37
(D-Phe7)-Somatostatin-14 structure
|
Common Name | (D-Phe7)-Somatostatin-14 | ||
|---|---|---|---|---|
| CAS Number | 64813-74-7 | Molecular Weight | 1639.894 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1980.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C76H106N18O19S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1151.3±34.3 °C | |
Use of (D-Phe7)-Somatostatin-14(D-Phe7)-Somatostatin-14 is a biologically active peptide. |
| Name | (D-Phe7)-Somatostatin-14 |
|---|---|
| Synonym | More Synonyms |
| Description | (D-Phe7)-Somatostatin-14 is a biologically active peptide. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1980.1±65.0 °C at 760 mmHg |
| Molecular Formula | C76H106N18O19S2 |
| Molecular Weight | 1639.894 |
| Flash Point | 1151.3±34.3 °C |
| Exact Mass | 1638.732300 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | XWJDVNOOYSANGI-UHFFFAOYSA-N |
| SMILES | CC(N)C(=O)NCC(=O)NC(CS)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)NC(C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)NC(CO)C(=O)NC(CS)C(=O)O)C(C)O)C(C)O |
| D-Cysteine, L-alanylglycyl-L-cysteinyl-L-lysyl-L-asparaginyl-L-phenylalanyl-D-phenylalanyl-L-tryptophyl-L-lysyl-L-threonyl-L-phenylalanyl-L-threonyl-L-seryl- |
| L-Alanylglycyl-L-cysteinyl-L-lysyl-L-asparaginyl-L-phenylalanyl-D-phenylalanyl-L-tryptophyl-L-lysyl-L-threonyl-L-phenylalanyl-L-threonyl-L-seryl-D-cysteine |
| MFCD02261964 |
| [D-Phe7]-Somatostatin-14 |