4-hydroxynaphthalene-2,6-disulphonic acid structure
|
Common Name | 4-hydroxynaphthalene-2,6-disulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6483-80-3 | Molecular Weight | 304.29600 | |
| Density | 1.816g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxynaphthalene-2,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.816g/cm3 |
|---|---|
| Molecular Formula | C10H8O7S2 |
| Molecular Weight | 304.29600 |
| Exact Mass | 303.97100 |
| PSA | 145.73000 |
| LogP | 3.20040 |
| Index of Refraction | 1.725 |
| InChIKey | TXGYIIYGGRVNHK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(O)c2cc(S(=O)(=O)O)ccc2c1 |
| HS Code | 2908999090 |
|---|
|
~%
4-hydroxynaphth... CAS#:6483-80-3 |
| Literature: Freund Patent: DE27346 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 431 |
|
~%
4-hydroxynaphth... CAS#:6483-80-3 |
|
Literature: Freund Patent: DE27346 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 431 Full Text Show Details Taeuber; Norman Die Derivate des Naphthalins |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-Naphthol-3,7-disulfonicacid |
| 4-Hydroxy-naphthalin-2,6-disulfonsaeure |
| 4-hydroxy-naphthalene-2,6-disulfonic acid |
| EINECS 229-344-1 |
| 4-Hydroxynaphthalene-2,6-disulphonic acid |