4-methyl-N-(4-methylphenoxy)benzenesulfonamide structure
|
Common Name | 4-methyl-N-(4-methylphenoxy)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 65109-76-4 | Molecular Weight | 277.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-(4-methylphenoxy)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15NO3S |
|---|---|
| Molecular Weight | 277.33900 |
| Exact Mass | 277.07700 |
| PSA | 63.78000 |
| LogP | 4.04740 |
| InChIKey | KYPAWYJQFXGFCO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(ONS(=O)(=O)c2ccc(C)cc2)cc1 |
|
~%
4-methyl-N-(4-m... CAS#:65109-76-4 |
| Literature: Endo, Yasuyuki; Shudo, Koichi; Okamoto, Toshihiko Journal of the American Chemical Society, 1982 , vol. 104, # 23 p. 6393 - 6397 |
| Benzenesulfonamide,4-methyl-N-(4-methylphenoxy) |
| O-4-tolyl-N-tosylhydroxylamine |
| N-p-toluenesulfonyl-O-(4-tolyl)-hydroxylamine |