Boc-Val-Pro-Arg-AMC hydrochloride salt structure
|
Common Name | Boc-Val-Pro-Arg-AMC hydrochloride salt | ||
|---|---|---|---|---|
| CAS Number | 65147-04-8 | Molecular Weight | 627.73 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H45N7O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-Val-Pro-Arg-AMC hydrochloride saltBoc-Val-Pro-Arg-MCA is a sensitive fluorogenic substrate for measuring trypsin-like serine proteases activity[1]. |
| Name | boc-val-pro-arg-mca |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Val-Pro-Arg-MCA is a sensitive fluorogenic substrate for measuring trypsin-like serine proteases activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C31H45N7O7 |
| Molecular Weight | 627.73 |
| Exact Mass | 627.33800 |
| PSA | 208.95000 |
| LogP | 4.31190 |
| Index of Refraction | 1.619 |
| InChIKey | DFOSAUPKTFJBLO-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCCN=C(N)N)NC(=O)C3CCCN3C(=O)C(NC(=O)OC(C)(C)C)C(C)C)ccc12 |
| Boc-Val-Pro-Arg-AMC |
| tertiary-butyloxycarbonyl-valyl-prolyl-arginyl-7-amino-4-methylcoumarin |
| T-BUTYLOXYCARBONYL-L-VALYL-L-PROLYL-L-ARGININE 4-METHYLCOUMARYL-7-AMIDE |