H-Gly-Arg-AMC hydrochloride salt structure
|
Common Name | H-Gly-Arg-AMC hydrochloride salt | ||
|---|---|---|---|---|
| CAS Number | 65147-19-5 | Molecular Weight | 388.421 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H24N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Gly-Arg-AMC hydrochloride saltGly-Arg-AMC is a peptide substrate of DPAP1[1]. |
| Name | H-Gly-Arg-AMC |
|---|---|
| Synonym | More Synonyms |
| Description | Gly-Arg-AMC is a peptide substrate of DPAP1[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.421 |
| Exact Mass | 388.185913 |
| LogP | -0.19 |
| Index of Refraction | 1.664 |
| InChIKey | JNTASUHAFOHMQK-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCCN=C(N)N)NC(=O)CN)ccc12 |
| L-Ornithinamide, glycyl-N-(diaminomethylene)-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)- |
| Glycyl-N-(diaminomethylene)-N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-ornithinamide |
| glycyl-N-(diaminomethylidene)-N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-ornithinamide |