1-(tert-butylamino)anthracene-9,10-dione structure
|
Common Name | 1-(tert-butylamino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 65270-01-1 | Molecular Weight | 279.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(tert-butylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H17NO2 |
|---|---|
| Molecular Weight | 279.33300 |
| Exact Mass | 279.12600 |
| PSA | 46.17000 |
| LogP | 3.74540 |
| InChIKey | HGOCIIJWUIKMNF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Nc1cccc2c1C(=O)c1ccccc1C2=O |
|
~%
1-(tert-butylam... CAS#:65270-01-1 |
| Literature: Mita, Katsuhisa; Yamagishi, Takamichi; Hida, Mitsuhiko Journal of the Chemical Society, Chemical Communications, 1980 , # 21 p. 1036 - 1037 |
|
~%
1-(tert-butylam... CAS#:65270-01-1 |
| Literature: Bradley; Maisey Journal of the Chemical Society, 1954 , p. 247,249 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 9,10-Anthracenedione,1-[(1,1-dimethylethyl)amino] |
| 1-tert-butylamino-anthraquinone |
| 1-tert-Butylamino-anthrachinon |
| 1-t-Butylaminoanthraquinone |