Nicotinamide, 2-(p-anisidino)-N-methyl- structure
|
Common Name | Nicotinamide, 2-(p-anisidino)-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 65423-33-8 | Molecular Weight | 257.28800 | |
| Density | 1.207g/cm3 | Boiling Point | 466.1ºC at 760 mmHg | |
| Molecular Formula | C14H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | 2-(4-methoxyanilino)-N-methylpyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 466.1ºC at 760 mmHg |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.28800 |
| Flash Point | 235.7ºC |
| Exact Mass | 257.11600 |
| PSA | 66.74000 |
| LogP | 2.84120 |
| Index of Refraction | 1.611 |
| InChIKey | YVKLLYDPDWCODC-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1cccnc1Nc1ccc(OC)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(p-methoxy(phenylamino))-n-methylnicotinamide |
| Nicotinamide,2-(p-methoxyanilino)-N-methyl |
| 2-(4-methoxy-anilino)-N-methyl-nicotinamide |
| Nicotinamide,2-(p-anisidino)-N-methyl |
| 2-(p-Methoxyanilino)-N-methylnicotinamide |