5-(2-Chloroacetyl)indolin-2-one structure
|
Common Name | 5-(2-Chloroacetyl)indolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 65435-04-3 | Molecular Weight | 209.629 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 460.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H8ClNO2 | Melting Point | 228-232ºC | |
| MSDS | N/A | Flash Point | 232.5±28.7 °C | |
| Name | 5-Chloroacetyloxindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 460.8±45.0 °C at 760 mmHg |
| Melting Point | 228-232ºC |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.629 |
| Flash Point | 232.5±28.7 °C |
| Exact Mass | 209.024353 |
| PSA | 46.17000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | WXJWBEAGVWVEDM-UHFFFAOYSA-N |
| SMILES | O=C1Cc2cc(C(=O)CCl)ccc2N1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
|
~10%
5-(2-Chloroacet... CAS#:65435-04-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 6 p. 1860 - 1866 |
|
~%
5-(2-Chloroacet... CAS#:65435-04-3 |
| Literature: US4831031 A1, ; |
| 2H-Indol-2-one, 5-(2-chloroacetyl)-1,3-dihydro- |
| MFCD04115734 |
| 5-(2-chloroacetyl)-1,3-dihydroindol-2-one |
| 5-(Chloroacetyl)-1,3-dihydro-2H-indol-2-one |