S-(2-benzyl-3-chloro-3-oxopropyl) ethanethioate structure
|
Common Name | S-(2-benzyl-3-chloro-3-oxopropyl) ethanethioate | ||
|---|---|---|---|---|
| CAS Number | 65444-05-5 | Molecular Weight | 256.74800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(2-benzyl-3-chloro-3-oxopropyl) ethanethioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13ClO2S |
|---|---|
| Molecular Weight | 256.74800 |
| Exact Mass | 256.03200 |
| PSA | 59.44000 |
| LogP | 2.89040 |
| InChIKey | SYIWWWZVQZBRJE-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)Cl |
|
~%
S-(2-benzyl-3-c... CAS#:65444-05-5 |
| Literature: Mimura; Nakamura; Nishino; Sawayama; Komiya; Deguchi; Kita; Matsumoto Journal of Medicinal Chemistry, 1992 , vol. 35, # 3 p. 602 - 608 |
|
~%
S-(2-benzyl-3-c... CAS#:65444-05-5 |
| Literature: Mallikarjun Reddy; Moses Babu; Sudhakar; Sharma; Sudershan Reddy; Vyas Pharmazie, 2006 , vol. 61, # 12 p. 994 - 998 |
|
~%
S-(2-benzyl-3-c... CAS#:65444-05-5 |
| Literature: E. R. Squibb and Sons, Inc. Patent: US4053651 A1, 1977 ; US 4053651 A |
|
~%
S-(2-benzyl-3-c... CAS#:65444-05-5 |
| Literature: Societe Civile Bioprojet Patent: US6013829 A1, 2000 ; US 6013829 A |
|
~%
S-(2-benzyl-3-c... CAS#:65444-05-5 |
| Literature: Mallikarjun Reddy; Moses Babu; Sudhakar; Sharma; Sudershan Reddy; Vyas Pharmazie, 2006 , vol. 61, # 12 p. 994 - 998 |
|
~%
S-(2-benzyl-3-c... CAS#:65444-05-5 |
| Literature: Mallikarjun Reddy; Moses Babu; Sudhakar; Sharma; Sudershan Reddy; Vyas Pharmazie, 2006 , vol. 61, # 12 p. 994 - 998 |
| Ethanethioic acid,S-[3-chloro-3-oxo-2-(phenylmethyl)propyl] ester |
| 2-acetylthiomethyl-3-phenylpropanoyl chloride |
| 3-acetylthio-2-benzylpropanoic acid chloride |
| 2-acetylthiomethyl-3-phenylpropionyl chloride |
| S-Acetyl-3-Phenyl-2-(mercaptomethyl)propionyl chloride |
| 3-(acetylthio)-2-benzylpropanoyl chloride |